24,25-Dihydrolanosterol (BioCAD00000003233)
Metabolite Card
Formula: C30H52O (428.4018)
SMILES: [H][C@@](C)(CCCC(C)C)[C@@]1([H])CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3
Synonyms [en]
24,25-Dihydrolanosterol; Lanostenol; 5alpha-Lanost-8-en-3beta-ol; Dihydrolanosterol; Lanost-8-en-3-ol; 24-dihydrolanosterol
Reviewed
Last reviewed on 2024-06-28.
Cite this Page
24,25-Dihydrolanosterol. 数据之源，洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000003233). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
24,25-Dihydrolanosterol is involved in the biosynthesis of steriods. 24,25-Dihydrolanosterol is reversibly converted to lanosterol by delta24-sterol reductase [EC:1.3.1.72].
Entity Information
DBLinks
- CAS Registry Number: 79-62-9
- PubChem CID: 440560
- ChEBI: 28113
- HMDB: HMDB0006839
- LipidMaps: LMST01010087
- KEGG: C05109
- BioCyc: CPD-8606
- NCBI MeSH: lanostenol
- Wikipedia: Dihydrolanosterol
Other DBLinks
- CAS Registry Number: 79-62-9
- PubChem: 440560
- ChEBI: ChEBI:28113
- HMDB: HMDB0006839
- LipidMaps: LMST01010087
- KEGG: C05109
- BioCyc: CPD-8606
- NCBI MeSH: lanostenol
- Wikipedia: Dihydrolanosterol
- RefMet: RM0135657
- MoNA: FiehnLib000052
- MoNA: HMDB0006839_c_ms_99936
- MoNA: HMDB0006839_c_ms_99937
- MoNA: HMDB0006839_c_ms_99938
- MoNA: JP002697
- MoNA: JP008185
- Metlin: METLIN_3905
- Coconut NaturalProduct: CNP0169560.1
Class / Ontology
- WishartLab ClassyFire: [Triterpenoids] Triterpenoids
- RefMet: [Cholesterols] Cholesterols
- LipidMaps: [Cholesterol and derivatives [ST0101]] Cholesterol and derivatives [ST0101]
- ChEBI: [CHEBI:28113] 24,25-dihydrolanosterol
- Coconut NaturalProduct: [Lanostane, Tirucallane and Euphane triterpenoids] Lanostane, Tirucallane and Euphane triterpenoids
Metabolic Network
| ID | EC Number | Name |
|---|---|---|
| KEGG:R03689 | 1.3.1.72 | lanosterol delta24-reductase |
| KEGG:R04670 | C05109 + C00005<=>C05110 + C00006 | |
| Rhea:RHEA:33920 | lanosterol + NADPH + H+ => 24,25-dihydrolanosterol + NADP+ | |
| Rhea:RHEA:33921 | 24,25-dihydrolanosterol + NADP+ => lanosterol + NADPH + H+ | |
| Rhea:RHEA:33922 | lanosterol + NADPH + H+ <=> 24,25-dihydrolanosterol + NADP+ | |
| Rhea:RHEA:45961 | 24,25-dihydrolanosterol + 3 reduced [NADPH—hemoprotein reductase] + 3 O2 => 4,4-dimethyl-8,14-cholestadien-3β-ol + formate + 3 oxidized [NADPH—hemoprotein reductase] + 4 H2O + 4 H+ | |
| Rhea:RHEA:45962 | 4,4-dimethyl-8,14-cholestadien-3β-ol + formate + 3 oxidized [NADPH—hemoprotein reductase] + 4 H2O + 4 H+ => 24,25-dihydrolanosterol + 3 reduced [NADPH—hemoprotein reductase] + 3 O2 | |
| Rhea:RHEA:45963 | 24,25-dihydrolanosterol + 3 reduced [NADPH—hemoprotein reductase] + 3 O2 <=> 4,4-dimethyl-8,14-cholestadien-3β-ol + formate + 3 oxidized [NADPH—hemoprotein reductase] + 4 H2O + 4 H+ | |
| Rhea:RHEA:56761 | 24,25-dihydrolanosterol + 6 reduced [2Fe-2S]-[ferredoxin] + 3 O2 + 5 H+ => 4,4-dimethyl-8,14-cholestadien-3β-ol + formate + 6 oxidized [2Fe-2S]-[ferredoxin] + 4 H2O | |
| Rhea:RHEA:56762 | 4,4-dimethyl-8,14-cholestadien-3β-ol + formate + 6 oxidized [2Fe-2S]-[ferredoxin] + 4 H2O => 24,25-dihydrolanosterol + 6 reduced [2Fe-2S]-[ferredoxin] + 3 O2 + 5 H+ | |
| Rhea:RHEA:56763 | 24,25-dihydrolanosterol + 6 reduced [2Fe-2S]-[ferredoxin] + 3 O2 + 5 H+ <=> 4,4-dimethyl-8,14-cholestadien-3β-ol + formate + 6 oxidized [2Fe-2S]-[ferredoxin] + 4 H2O | |
| Rhea:RHEA:75080 | 24,25-dihydrolanosterol + reduced [NADPH—hemoprotein reductase] + O2 => 32-hydroxy-24,25-dihydrolanosterol + oxidized [NADPH—hemoprotein reductase] + H2O + H+ | |
| Rhea:RHEA:75081 | 32-hydroxy-24,25-dihydrolanosterol + oxidized [NADPH—hemoprotein reductase] + H2O + H+ => 24,25-dihydrolanosterol + reduced [NADPH—hemoprotein reductase] + O2 | |
| Rhea:RHEA:75082 | 24,25-dihydrolanosterol + reduced [NADPH—hemoprotein reductase] + O2 <=> 32-hydroxy-24,25-dihydrolanosterol + oxidized [NADPH—hemoprotein reductase] + H2O + H+ | |
| BioCyc:RXN66-11 | 24,25-dihydrolanosterol 14-hydroxylase | |
| BioCyc:RXN-13707 | 1.14.14.154 | 24,25-dihydrolanosterol 14-demethylase |
| BioCyc:RXN66-10 | 1.3.1.72 | LANOSTEROL + NADPH + PROTON --> CPD-8606 + NADP |
Mass Spectrum
Organism Source
Taxonomy Source
- Fomes annosus [ncbi taxid: ]
- Fomes fomentarius [ncbi taxid: 40442]
- Fomes pini [ncbi taxid: ]
- Homo sapiens [ncbi taxid: 9606]
- Mus musculus [ncbi taxid: 10090]
- Saccharomyces cerevisiae [ncbi taxid: 4932]
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:HUMAN_PWY66-5 | superpathway of cholesterol biosynthesis |
| BioCyc:HUMAN_PWY66-3 | cholesterol biosynthesis II (via 24,25-dihydrolanosterol) |
| BioCyc:META_PWY66-3 | cholesterol biosynthesis II (via 24,25-dihydrolanosterol) |
| BioCyc:META_PWY66-5 | superpathway of cholesterol biosynthesis |
| Plant Reactome:R-OSA-2744345 | Metabolism and regulation |
| Plant Reactome:R-OSA-1119286 | Cholesterol biosynthesis II (via 24,25-dihydrolanosterol) |
| Plant Reactome:R-OSA-3906998 | Fatty acid and lipid metabolism |
| Reactome:R-BTA-1430728 | Metabolism |
| Reactome:R-BTA-556833 | Metabolism of lipids |
| Reactome:R-BTA-191273 | Cholesterol biosynthesis |
| Reactome:R-CEL-191273 | Cholesterol biosynthesis |
| Reactome:R-CFA-1430728 | Metabolism |
| Reactome:R-CFA-556833 | Metabolism of lipids |
| Reactome:R-CFA-191273 | Cholesterol biosynthesis |
| Reactome:R-DRE-6807062 | Zymostenol biosynthesis via lathosterol (Kandutsch-Russell pathway) |
| Reactome:R-GGA-191273 | Cholesterol biosynthesis |
| Reactome:R-MMU-1430728 | Metabolism |
| Reactome:R-MMU-556833 | Metabolism of lipids |
| Reactome:R-MMU-8957322 | Metabolism of steroids |
| Reactome:R-RNO-6807062 | Zymostenol biosynthesis via lathosterol (Kandutsch-Russell pathway) |