beta-D-Galactose (BioCAD00000007289)
feces bladder brain epidermis fibroblasts intestine kidney liver neuron ovary placenta platelet skeletal muscle spleen testis
Metabolite Card
Formula: C6H12O6 (180.0634)
SMILES: OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O
Synonyms [en]
beta-D-galactose; Gal-beta; beta-D-Gal; beta-D-galactopyranose; beta-D-Galactoside; beta-Galactose
Last reviewed on 2024-06-28.
Cite this Page
beta-D-Galactose. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000007289). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
Galactose is an optical isomer of glucose. An aldohexose that occurs naturally in the D-form in lactose, cerebrosides, gangliosides, and mucoproteins. Deficiency of galactosyl-1-phosphate uridyltransferase (Galactose-1-phosphate uridyl-transferase deficiency disease) causes an error in galactose metabolism called galactosemia, resulting in elevations of galactose in the blood. Galactose (Gal) (also called brain sugar) is a type of sugar found in dairy products, in sugar beets and other gums and mucilages. It is also synthesized by the body, where it forms part of glycolipids and glycoproteins in several tissues. It is considered a nutritive sweetener because it has food energy. Galactose is less sweet than glucose and not very water-soluble. Galactose is a monosaccharide constituent, together with glucose, of the disaccharide lactose. The hydrolysis of lactose to glucose and galactose is catalyzed by the enzyme beta-galactosidase, a lactase. In the human body, glucose is changed into galactose in order to enable the mammary glands to secrete lactose. Galactan is a polymer of the sugar galactose. It is found in hemicellulose and can be converted to galactose by hydrolysis.
DBLinks
- CAS Registry Number: 7296-64-2
- PubChem CID: 439353
- ChEBI: 27667
- HMDB: HMDB0003449
- LipidMaps:
- KEGG: C00962
- BioCyc: GALACTOSE
- NCBI MeSH: sarcotoxin IIB protein, Sarcophaga peregrina
- Wikipedia:
Other DBLinks
- CAS Registry Number: 105430-43-1
- CAS Registry Number: 7296-64-2
- CAS Registry Number: 9031-11-2
- PubChem: 439353
- ChEBI: ChEBI:27667
- HMDB: HMDB0003449
- KEGG: C00962
- BioCyc: GALACTOSE
- NCBI MeSH: sarcotoxin IIB protein, Sarcophaga peregrina
- MoNA: HMDB0003449_ms_ms_2316
- MoNA: HMDB0003449_ms_ms_2317
- MoNA: HMDB0003449_ms_ms_2318
- Coconut NaturalProduct: CNP0210547.7
Class / Ontology
- WishartLab ClassyFire: [Carbohydrates and carbohydrate conjugates] Carbohydrates and carbohydrate conjugates
- ChEBI: [CHEBI:27667] beta-D-galactose
- Coconut NaturalProduct: [Disaccharides] Disaccharides
| ID | EC Number | Name |
|---|---|---|
| KEGG:R01100 | 3.2.1.23 | lactose galactohydrolase |
| KEGG:R06114 | 3.2.1.23 | G10504 + C00001<=>C00031 + C00962 |
| KEGG:R12970 | 3.2.1.62 | beta-D-galactosyl-N-acylsphingosine glycohydrolase (configuration-retaining) |
| BioCyc:ALDOSE1EPIM-RXN | 5.1.3.3 | GALACTOSE --> ALPHA-D-GALACTOSE |
| BioCyc:BETAGALACTOSID-RXN | 3.2.1.108 | CPD-15972 + WATER --> GALACTOSE + Glucopyranose |
| BioCyc:RXN-17726 | 3.2.1.- | CPD-3561 + WATER --> GALACTOSE + Fructofuranose |
| Rhea:RHEA:10077 | 3.2.1.108 | lactose + H2O => β-D-galactose + D-glucose |
| Rhea:RHEA:10078 | 3.2.1.108 | β-D-galactose + D-glucose => lactose + H2O |
| Rhea:RHEA:10079 | 3.2.1.108 | lactose + H2O <=> β-D-galactose + D-glucose |
| Rhea:RHEA:28660 | β-lactose + H2O => β-D-galactose + β-D-glucose | |
| Rhea:RHEA:28661 | β-D-galactose + β-D-glucose => β-lactose + H2O | |
| Rhea:RHEA:28662 | β-lactose + H2O <=> β-D-galactose + β-D-glucose | |
| Rhea:RHEA:28676 | 5.1.3.3 | α-D-galactose => β-D-galactose |
| Rhea:RHEA:28677 | 5.1.3.3 | β-D-galactose => α-D-galactose |
| Rhea:RHEA:28678 | 5.1.3.3 | α-D-galactose <=> β-D-galactose |
| Rhea:RHEA:30012 | β-D-galactose(out) + ATP + H2O => β-D-galactose(in) + ADP + phosphate + H+ | |
| Rhea:RHEA:30013 | β-D-galactose(in) + ADP + phosphate + H+ => β-D-galactose(out) + ATP + H2O | |
| Rhea:RHEA:30014 | β-D-galactose(out) + ATP + H2O <=> β-D-galactose(in) + ADP + phosphate + H+ | |
| Rhea:RHEA:69704 | β-D-galactosyl-(1↔1ʼ)-N-hexadecanoylsphing-4-enine + H2O => β-D-galactose + N-hexadecanoylsphing-4-enine | |
| Rhea:RHEA:69705 | β-D-galactose + N-hexadecanoylsphing-4-enine => β-D-galactosyl-(1↔1ʼ)-N-hexadecanoylsphing-4-enine + H2O |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:HUMAN_BGALACT-PWY | lactose degradation III |
| BioCyc:META_PWY66-422 | D-galactose degradation V (Leloir pathway) |
| BioCyc:META_PWY-6317 | D-galactose degradation I (Leloir pathway) |
| BioCyc:META_PWY-6791 | xyloglucan degradation I (endoglucanase) |
| BioCyc:VCHO_PWY-6317 | D-galactose degradation I (Leloir pathway) |
| BioCyc:MTBH37RV_PWY-6317 | D-galactose degradation I (Leloir pathway) |
| BioCyc:ECOO157_BGALACT-PWY | lactose degradation III |
| BioCyc:ECOL199310_BGALACT-PWY | lactose degradation III |
| BioCyc:MOUSE_PWY-6317 | galactose degradation I (Leloir pathway) |
| BioCyc:SMAN_BGALACT-PWY | lactose degradation III |
| BioCyc:BSUB_PWY-6317 | D-galactose degradation I (Leloir pathway) |
| BioCyc:ECOL316407_BGALACT-PWY | lactose degradation III |
| BioCyc:ECOL316407_GALACTMETAB-PWY | galactose degradation I (Leloir pathway) |
| BioCyc:ECOL413997_GALACTMETAB-PWY | galactose degradation I (Leloir pathway) |
| BioCyc:THAPS_BGALACT-PWY | lactose degradation III |
| BioCyc:CLOSSAC_PWY-6317 | galactose degradation I (Leloir pathway) |
| BioCyc:CLOSTSYMB_BGALACT-PWY | lactose degradation III |
| BioCyc:CLOSTSYMB_PWY-6317 | D-galactose degradation I (Leloir pathway) |
| BioCyc:PRECOPRI_BGALACT-PWY | lactose degradation III |
| BioCyc:PRECOPRI_PWY-6317 | D-galactose degradation I (Leloir pathway) |