2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol (BioCAD00000056687)
{$topic}
Metabolite Card
Formula: C57H88O3 (820.6733)
SMILES: [H]\C(CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC1=CC(O)=CC(OC)=C1O)=C(\C)CCC=C(C)C
Synonyms [en]
6-Decaprenyl-2-methoxyhydroquinone; 6-Methoxy-2-decaprenylhydroquinone; 2-Decaprenyl-6-methoxy-1,4-benzoquinol; 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol; 6-all-trans-Decaprenyl-2-methoxy-1,4-benzoquinol; 2-Methoxy-6-all-trans-decaprenyl-1,4-benzoquinol
Last reviewed on 2024-06-28.
Cite this Page
2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000056687). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol is also known as 2-Methoxy-6-decaprenylhydroquinone or 6-Decaprenyl-2-methoxyhydroquinone. 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol is considered to be practically insoluble (in water) and acidic
DBLinks
- CAS Registry Number:
- PubChem CID: 50986248
- ChEBI: 64180
- HMDB: HMDB0062197
- LipidMaps:
- KEGG:
- BioCyc:
- NCBI MeSH:
- Wikipedia:
Other DBLinks
- PubChem: 50986248
- ChEBI: ChEBI:64180
- HMDB: HMDB0062197
Class / Ontology
- WishartLab ClassyFire: [Quinone and hydroquinone lipids] Quinone and hydroquinone lipids
| ID | EC Number | Name |
|---|---|---|
| Rhea:RHEA:44765 | 2.1.1.201 | 2-methoxy-6-(all-trans-decaprenyl)benzene-1,4-diol + S-adenosyl-L-methionine => 5-methoxy-2-methyl-3-(all-trans-decaprenyl)benzene-1,4-diol + S-adenosyl-L-homocysteine + H+ |
| Rhea:RHEA:44766 | 2.1.1.201 | 5-methoxy-2-methyl-3-(all-trans-decaprenyl)benzene-1,4-diol + S-adenosyl-L-homocysteine + H+ => 2-methoxy-6-(all-trans-decaprenyl)benzene-1,4-diol + S-adenosyl-L-methionine |
| Rhea:RHEA:44767 | 2.1.1.201 | 2-methoxy-6-(all-trans-decaprenyl)benzene-1,4-diol + S-adenosyl-L-methionine <=> 5-methoxy-2-methyl-3-(all-trans-decaprenyl)benzene-1,4-diol + S-adenosyl-L-homocysteine + H+ |
| Rhea:RHEA:81296 | 1.14.15.46 | 2-methoxy-6-(all-trans-decaprenyl)phenol + 2 reduced [2Fe-2S]-[ferredoxin] + O2 + 2 H+ => 2-methoxy-6-(all-trans-decaprenyl)benzene-1,4-diol + 2 oxidized [2Fe-2S]-[ferredoxin] + H2O |
| Rhea:RHEA:81297 | 1.14.15.46 | 2-methoxy-6-(all-trans-decaprenyl)benzene-1,4-diol + 2 oxidized [2Fe-2S]-[ferredoxin] + H2O => 2-methoxy-6-(all-trans-decaprenyl)phenol + 2 reduced [2Fe-2S]-[ferredoxin] + O2 + 2 H+ |
| Rhea:RHEA:81298 | 1.14.15.46 | 2-methoxy-6-(all-trans-decaprenyl)phenol + 2 reduced [2Fe-2S]-[ferredoxin] + O2 + 2 H+ <=> 2-methoxy-6-(all-trans-decaprenyl)benzene-1,4-diol + 2 oxidized [2Fe-2S]-[ferredoxin] + H2O |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:HUMAN_PWY-5872 | ubiquinol-10 biosynthesis |
| BioCyc:META_PWY-5872 | ubiquinol-10 biosynthesis (eukaryotic) |
| BioCyc:META_PWY-5857 | ubiquinol-10 biosynthesis (prokaryotic) |
| PlantCyc:CVARIABILIS_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:CHLAMY_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:AHALLERI_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:AHYPOCHONDRIACUS_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:ALYRATA_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:SPIRODELA_PWY-5872 | ubiquinol-10 biosynthesis (eukaryotic) |
| PlantCyc:CORN_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:CZOFINGIENSIS_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:BANANA_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:WHEATD_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:PLANT_PWY-5872 | ubiquinol-10 biosynthesis (eukaryotic) |
| PlantCyc:AMBORELLA_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:ASPARAGUS_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:SOLERACEA_PWY-5872 | ubiquinol-10 biosynthesis (eukaryotic) |
| PlantCyc:CCAMPESTRIS_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:POTATO_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |
| PlantCyc:BREADWHEAT_PWY-5872 | ubiquinol-10 biosynthesis (late decarboxylation) |