N(6),N(6),N(6)-trimethyl-L-lysine zwitterion (BioCAD00000478932)
{$topic}
Metabolite Card
Formula: C9H21N2O2 (189.1603)
SMILES: C[N+](C)(C)CCCC[C@H]([NH3+])C([O-])=O
Synonyms [en]
N(6),N(6),N(6)-trimethyl-L-lysine zwitterion; (2S)-2-azaniumyl-6-(trimethylazaniumyl)hexanoate; N(6),N(6),N(6)-trimethyl-L-lysine; trimethyllysine chloride, (S)-isomer; trimethyllysine hydroxide,inner salt, (+-)-isomer; epsilon-N-trimethyl-lysine
Last reviewed on 2024-06-28.
Cite this Page
N(6),N(6),N(6)-trimethyl-L-lysine zwitterion. 数据之源,洞见之始. SMRUCC genomics institute, a synthetic life researcher from China.
https://biocad_registry.innovation.ac.cn/s/(-)-arctiin
(retrieved
2026-01-03) (CAD Registry RN: BioCAD00000478932). Licensed
under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
Note
A zwitterionic form of N(6),N(6),N(6)-trimethyl-L-lysinium cation arising from transfer of a proton from the carboxy to the amino group; major species at pH 7.3" []
DBLinks
- CAS Registry Number: 19253-88-4
- PubChem CID: 6992003
- ChEBI: 58100
- HMDB:
- LipidMaps:
- KEGG:
- BioCyc:
- NCBI MeSH: trimethyllysine
- Wikipedia:
Other DBLinks
- CAS Registry Number: 19253-88-4
- PubChem: 6992003
- ChEBI: ChEBI:58100
- NCBI MeSH: trimethyllysine
Class / Ontology
| ID | EC Number | Name |
|---|---|---|
| Rhea:RHEA:14182 | 1.14.11.8 | N6,N6,N6-trimethyl-L-lysine + 2-oxoglutarate + O2 => (3S)-3-hydroxy-N6,N6,N6-trimethyl-L-lysine + succinate + CO2 |
| Rhea:RHEA:14183 | 1.14.11.8 | (3S)-3-hydroxy-N6,N6,N6-trimethyl-L-lysine + succinate + CO2 => N6,N6,N6-trimethyl-L-lysine + 2-oxoglutarate + O2 |
| Rhea:RHEA:14184 | 1.14.11.8 | N6,N6,N6-trimethyl-L-lysine + 2-oxoglutarate + O2 <=> (3S)-3-hydroxy-N6,N6,N6-trimethyl-L-lysine + succinate + CO2 |
Taxonomy Source
Pathway Synthetic
| pathway id | name |
|---|---|
| BioCyc:META_PWY-6100 | L-carnitine biosynthesis |
| BioCyc:HUMAN_PWY-6100 | L-carnitine biosynthesis |
| BioCyc:MOUSE_PWY-6100 | L-carnitine biosynthesis |
| BioCyc:FLY_PWY-6100 | L-carnitine biosynthesis |
| PlantCyc:CROSEUS_PWY-6100 | L-carnitine biosynthesis |
| PlantCyc:TPARVULA_PWY-6100 | L-carnitine biosynthesis |
| PlantCyc:CORKOAK_PWY-6100 | L-carnitine biosynthesis |
| Reactome:R-BTA-1430728 | Metabolism |
| Reactome:R-BTA-71291 | Amino acid and derivative metabolism |
| Reactome:R-BTA-71262 | Carnitine synthesis |
| Reactome:R-CFA-1430728 | Metabolism |
| Reactome:R-DRE-71291 | Amino acid and derivative metabolism |
| Reactome:R-DRE-71262 | Carnitine synthesis |
| Reactome:R-MMU-1430728 | Metabolism |
| Reactome:R-CFA-71291 | Amino acid and derivative metabolism |
| Reactome:R-CFA-71262 | Carnitine synthesis |
| Reactome:R-DME-1430728 | Metabolism |
| Reactome:R-DME-71291 | Amino acid and derivative metabolism |
| Reactome:R-DME-71262 | Carnitine synthesis |
| Reactome:R-GGA-71291 | Amino acid and derivative metabolism |